
Tag Name Smiles Reactions
PTDBCOF00004 DMAPP CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] 508
PTDBCOF00326 MAPP C/C=C/COP(=O)([O-])OP(=O)([O-])[O-] 47
PTDBCOF00329 HELLO CC/C=C/COP(=O)([O-])OP(=O)([O-])[O-] 47
PTDBCOF00334 BENZYLPP O=P([O-])([O-])OP(=O)([O-])OCc1ccccc1 39
PTDBCOF00346 GERANYLPP CC(C)=CCC/C(C)=C/COP(=O)([O-])OP(=O)([O-])[O-] 15
PTDBCOF00348 FARNESYLPP CC(C)=CCC/C(C)=C/CC/C(C)=C/COP(=O)([O-])OP(=O)([O-])[O-] 15